About 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione
1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione (PubChem CID 11056301) has the molecular formula C18H16N4O2
and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione.
Molecular Properties
| Compound Name | 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione |
| PubChem CID | 11056301 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione |
| SMILES | CCn1c(=O)c2c(nc3ccccn32)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C18H16N4O2/c1-2-20-17(23)15-16(19-14-10-6-7-11-21(14)15)22(18(20)24)12-13-8-4-3-5-9-13/h3-11H,2,12H2,1H3 |
| InChIKey | YEHUFKUQNJXVNS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione?
The IUPAC name of 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione (CID 11056301) is 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione.
What is the SMILES notation for 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione?
The canonical SMILES for 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione is CCn1c(=O)c2c(nc3ccccn32)n(Cc2ccccc2)c1=O.
What is the InChIKey of 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione?
The InChIKey is YEHUFKUQNJXVNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O2/c1-2-20-17(23)15-16(19-14-10-6-7-11-21(14)15)22(18(20)24)12-13-8-4-3-5-9-13/h3-11H,2,12H2,1H3.
What are the key properties of 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione?
1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione has a molecular weight of 320.35 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-ethylpurino[7,8-a]pyridine-2,4-dione is sourced from PubChem (CID 11056301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).