C25H24N4O4 — CID 110563659
N-[4-[1-(4-cyanophenyl)-4-(2,6-dimethylmorpholin-4-yl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide (PubChem CID 110563659) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[4-[1-(4-cyanophenyl)-4-(2,6-dimethylmorpholin-4-yl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[1-(4-cyanophenyl)-4-(2,6-dimethylmorpholin-4-yl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110563659 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[4-[1-(4-cyanophenyl)-4-(2,6-dimethylmorpholin-4-yl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(N3CC(C)OC(C)C3)C(=O)N(c3ccc(C#N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H24N4O4/c1-15-13-28(14-16(2)33-15)23-22(19-6-8-20(9-7-19)27-17(3)30)24(31)29(25(23)32)21-10-4-18(12-26)5-11-21/h4-11,15-16H,13-14H2,1-3H3,(H,27,30) |
| InChIKey | VDEGNOOLZRBHCD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|