C26H23FN2O4 — CID 110564740
3-[benzyl(methyl)amino]-4-(3,4-dimethoxyphenyl)-1-(2-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110564740) has the molecular formula C26H23FN2O4 and a molecular weight of 446.48 g/mol. Its IUPAC name is 3-[benzyl(methyl)amino]-4-(3,4-dimethoxyphenyl)-1-(2-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 3-[benzyl(methyl)amino]-4-(3,4-dimethoxyphenyl)-1-(2-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110564740 |
| Molecular Formula | C26H23FN2O4 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 3-[benzyl(methyl)amino]-4-(3,4-dimethoxyphenyl)-1-(2-fluorophenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(N(C)Cc3ccccc3)C(=O)N(c3ccccc3F)C2=O)cc1OC |
| InChI | InChI=1S/C26H23FN2O4/c1-28(16-17-9-5-4-6-10-17)24-23(18-13-14-21(32-2)22(15-18)33-3)25(30)29(26(24)31)20-12-8-7-11-19(20)27/h4-15H,16H2,1-3H3 |
| InChIKey | PDFAKECNUJUKLL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|