C16H22O7 — CID 11056477
[(2S,3S)-3-[(E)-3,3-diacetyloxyprop-1-enyl]-6-methyl-3,4-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 11056477) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is [(2S,3S)-3-[(E)-3,3-diacetyloxyprop-1-enyl]-6-methyl-3,4-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3S)-3-[(E)-3,3-diacetyloxyprop-1-enyl]-6-methyl-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11056477 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(2S,3S)-3-[(E)-3,3-diacetyloxyprop-1-enyl]-6-methyl-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(C)=CC[C@H]1/C=C/C(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C16H22O7/c1-10-5-6-14(15(21-10)9-20-11(2)17)7-8-16(22-12(3)18)23-13(4)19/h5,7-8,14-16H,6,9H2,1-4H3/b8-7+/t14-,15+/m0/s1 |
| InChIKey | PLCYSSYKALKRRQ-MHKRFPNSSA-N |
| XLogP | 1.87 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|