C25H30N2O6 — CID 110564973
3-[bis(2-methoxyethyl)amino]-4-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110564973) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)amino]-4-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[bis(2-methoxyethyl)amino]-4-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110564973 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 3-[bis(2-methoxyethyl)amino]-4-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | COCCN(CCOC)C1=C(c2ccc(OC)c(OC)c2)C(=O)N(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C25H30N2O6/c1-17-6-9-19(10-7-17)27-24(28)22(18-8-11-20(32-4)21(16-18)33-5)23(25(27)29)26(12-14-30-2)13-15-31-3/h6-11,16H,12-15H2,1-5H3 |
| InChIKey | NGOVUSNAXRVWPA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|