About bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate
bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate (PubChem CID 11056539) has the molecular formula C13H16N2O8
and a molecular weight of 328.28 g/mol. Its IUPAC name is bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate |
| PubChem CID | 11056539 |
| Molecular Formula | C13H16N2O8 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate |
| SMILES | COC(=O)COC(=O)C1=C(C(=O)OCC(=O)OC)C(C)(C)N=N1 |
| InChI | InChI=1S/C13H16N2O8/c1-13(2)9(11(18)22-5-7(16)20-3)10(14-15-13)12(19)23-6-8(17)21-4/h5-6H2,1-4H3 |
| InChIKey | ZNGSLEFQBKMOFQ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate?
The IUPAC name of bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate (CID 11056539) is bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate.
What is the SMILES notation for bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate?
The canonical SMILES for bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate is COC(=O)COC(=O)C1=C(C(=O)OCC(=O)OC)C(C)(C)N=N1.
What is the InChIKey of bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate?
The InChIKey is ZNGSLEFQBKMOFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O8/c1-13(2)9(11(18)22-5-7(16)20-3)10(14-15-13)12(19)23-6-8(17)21-4/h5-6H2,1-4H3.
What are the key properties of bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate?
bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate has a molecular weight of 328.28 g/mol, XLogP of -0.08, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methoxy-2-oxoethyl) 5,5-dimethylpyrazole-3,4-dicarboxylate is sourced from PubChem (CID 11056539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).