C22H22ClNO4S — CID 110566458
3-(4-chlorophenyl)sulfanyl-1-(3-ethoxypropyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110566458) has the molecular formula C22H22ClNO4S and a molecular weight of 431.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-1-(3-ethoxypropyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-1-(3-ethoxypropyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110566458 |
| Molecular Formula | C22H22ClNO4S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-1-(3-ethoxypropyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOCCCN1C(=O)C(Sc2ccc(Cl)cc2)=C(c2ccccc2OC)C1=O |
| InChI | InChI=1S/C22H22ClNO4S/c1-3-28-14-6-13-24-21(25)19(17-7-4-5-8-18(17)27-2)20(22(24)26)29-16-11-9-15(23)10-12-16/h4-5,7-12H,3,6,13-14H2,1-2H3 |
| InChIKey | DAXOWCQVDONMBR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|