About 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one
2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one (PubChem CID 11056694) has the molecular formula C13H14Cl2N2O2S
and a molecular weight of 333.24 g/mol. Its IUPAC name is 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 11056694 |
| Molecular Formula | C13H14Cl2N2O2S |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCn1c(OCC2CC2(Cl)Cl)nc2sccc2c1=O |
| InChI | InChI=1S/C13H14Cl2N2O2S/c1-2-4-17-11(18)9-3-5-20-10(9)16-12(17)19-7-8-6-13(8,14)15/h3,5,8H,2,4,6-7H2,1H3 |
| InChIKey | FYHNKDRUJNSPNG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one (CID 11056694) is 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one is CCCn1c(OCC2CC2(Cl)Cl)nc2sccc2c1=O.
What is the InChIKey of 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one?
The InChIKey is FYHNKDRUJNSPNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N2O2S/c1-2-4-17-11(18)9-3-5-20-10(9)16-12(17)19-7-8-6-13(8,14)15/h3,5,8H,2,4,6-7H2,1H3.
What are the key properties of 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one?
2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one has a molecular weight of 333.24 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dichlorocyclopropyl)methoxy]-3-propylthieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 11056694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).