C24H30Cl2N2O2 — CID 110568334
1-cycloheptyl-3-(2,4-dichlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrrole-2,5-dione (PubChem CID 110568334) has the molecular formula C24H30Cl2N2O2 and a molecular weight of 449.42 g/mol. Its IUPAC name is 1-cycloheptyl-3-(2,4-dichlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-cycloheptyl-3-(2,4-dichlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568334 |
| Molecular Formula | C24H30Cl2N2O2 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-cycloheptyl-3-(2,4-dichlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrrole-2,5-dione |
| SMILES | CC1CC(C)CN(C2=C(c3ccc(Cl)cc3Cl)C(=O)N(C3CCCCCC3)C2=O)C1 |
| InChI | InChI=1S/C24H30Cl2N2O2/c1-15-11-16(2)14-27(13-15)22-21(19-10-9-17(25)12-20(19)26)23(29)28(24(22)30)18-7-5-3-4-6-8-18/h9-10,12,15-16,18H,3-8,11,13-14H2,1-2H3 |
| InChIKey | YUKTXMJFMKEQBY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|