C24H17Cl2FN2O2 — CID 110568670
3-(2,4-dichlorophenyl)-4-(N-ethylanilino)-1-(4-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110568670) has the molecular formula C24H17Cl2FN2O2 and a molecular weight of 455.32 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-(N-ethylanilino)-1-(4-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-(N-ethylanilino)-1-(4-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568670 |
| Molecular Formula | C24H17Cl2FN2O2 |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-(N-ethylanilino)-1-(4-fluorophenyl)pyrrole-2,5-dione |
| SMILES | CCN(C1=C(c2ccc(Cl)cc2Cl)C(=O)N(c2ccc(F)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C24H17Cl2FN2O2/c1-2-28(17-6-4-3-5-7-17)22-21(19-13-8-15(25)14-20(19)26)23(30)29(24(22)31)18-11-9-16(27)10-12-18/h3-14H,2H2,1H3 |
| InChIKey | ABUKQZKVYQAANY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|