C22H22ClNO5S — CID 110569231
3-(4-chlorophenyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110569231) has the molecular formula C22H22ClNO5S and a molecular weight of 447.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110569231 |
| Molecular Formula | C22H22ClNO5S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(CCN2C(=O)C(SCCO)=C(c3ccc(Cl)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C22H22ClNO5S/c1-28-17-8-3-14(13-18(17)29-2)9-10-24-21(26)19(15-4-6-16(23)7-5-15)20(22(24)27)30-12-11-25/h3-8,13,25H,9-12H2,1-2H3 |
| InChIKey | WYUQVAXVVPJBFJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|