About 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol
3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol (PubChem CID 11056960) has the molecular formula C16H22O3Se
and a molecular weight of 341.31 g/mol. Its IUPAC name is 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol.
Molecular Properties
| Compound Name | 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol |
| PubChem CID | 11056960 |
| Molecular Formula | C16H22O3Se |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol |
| SMILES | CO[C@@H]1C=C[C@H](C(C)C(O)C[Se]c2ccccc2)CO1 |
| InChI | InChI=1S/C16H22O3Se/c1-12(13-8-9-16(18-2)19-10-13)15(17)11-20-14-6-4-3-5-7-14/h3-9,12-13,15-17H,10-11H2,1-2H3/t12?,13-,15?,16-/m0/s1 |
| InChIKey | KTKIPRVETGKTFH-FQSHHYAASA-N |
| XLogP | 1.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol?
The IUPAC name of 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol (CID 11056960) is 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol.
What is the SMILES notation for 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol?
The canonical SMILES for 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol is CO[C@@H]1C=C[C@H](C(C)C(O)C[Se]c2ccccc2)CO1.
What is the InChIKey of 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol?
The InChIKey is KTKIPRVETGKTFH-FQSHHYAASA-N. The full InChI is InChI=1S/C16H22O3Se/c1-12(13-8-9-16(18-2)19-10-13)15(17)11-20-14-6-4-3-5-7-14/h3-9,12-13,15-17H,10-11H2,1-2H3/t12?,13-,15?,16-/m0/s1.
What are the key properties of 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol?
3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol has a molecular weight of 341.31 g/mol, XLogP of 1.61, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,6S)-6-methoxy-3,6-dihydro-2H-pyran-3-yl]-1-phenylselanylbutan-2-ol is sourced from PubChem (CID 11056960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).