C24H26N2O4 — CID 110571626
3-[3-(hydroxymethyl)piperidin-1-yl]-1-(3-methoxyphenyl)-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110571626) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)piperidin-1-yl]-1-(3-methoxyphenyl)-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[3-(hydroxymethyl)piperidin-1-yl]-1-(3-methoxyphenyl)-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110571626 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-[3-(hydroxymethyl)piperidin-1-yl]-1-(3-methoxyphenyl)-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | COc1cccc(N2C(=O)C(c3ccc(C)cc3)=C(N3CCCC(CO)C3)C2=O)c1 |
| InChI | InChI=1S/C24H26N2O4/c1-16-8-10-18(11-9-16)21-22(25-12-4-5-17(14-25)15-27)24(29)26(23(21)28)19-6-3-7-20(13-19)30-2/h3,6-11,13,17,27H,4-5,12,14-15H2,1-2H3 |
| InChIKey | SVFSNYDBCWRABE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|