C25H27N3O3 — CID 110571697
3-[2-hydroxyethyl(methyl)amino]-1-[2-(1-methylindol-3-yl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110571697) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-[2-hydroxyethyl(methyl)amino]-1-[2-(1-methylindol-3-yl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[2-hydroxyethyl(methyl)amino]-1-[2-(1-methylindol-3-yl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110571697 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3-[2-hydroxyethyl(methyl)amino]-1-[2-(1-methylindol-3-yl)ethyl]-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N(C)CCO)C(=O)N(CCc3cn(C)c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C25H27N3O3/c1-17-8-10-18(11-9-17)22-23(26(2)14-15-29)25(31)28(24(22)30)13-12-19-16-27(3)21-7-5-4-6-20(19)21/h4-11,16,29H,12-15H2,1-3H3 |
| InChIKey | VFWYCMSHFLPLBG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|