C12H9BrN6S — CID 11057196
(E)-1-(4-bromophenyl)-N-[5-(1,2,4-triazol-1-ylmethyl)-1,3,4-thiadiazol-2-yl]methanimine (PubChem CID 11057196) has the molecular formula C12H9BrN6S and a molecular weight of 349.22 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-N-[5-(1,2,4-triazol-1-ylmethyl)-1,3,4-thiadiazol-2-yl]methanimine.
| Compound Name | (E)-1-(4-bromophenyl)-N-[5-(1,2,4-triazol-1-ylmethyl)-1,3,4-thiadiazol-2-yl]methanimine |
|---|---|
| PubChem CID | 11057196 |
| Molecular Formula | C12H9BrN6S |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | (E)-1-(4-bromophenyl)-N-[5-(1,2,4-triazol-1-ylmethyl)-1,3,4-thiadiazol-2-yl]methanimine |
| SMILES | Brc1ccc(/C=N/c2nnc(Cn3cncn3)s2)cc1 |
| InChI | InChI=1S/C12H9BrN6S/c13-10-3-1-9(2-4-10)5-15-12-18-17-11(20-12)6-19-8-14-7-16-19/h1-5,7-8H,6H2/b15-5+ |
| InChIKey | RAPWPYCZWXILMO-PJQLUOCWSA-N |
| XLogP | 2.69 |
| TPSA | 68.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|