C15H13F2N5O3 — CID 11057201
(E)-1-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-N-methoxymethanimine (PubChem CID 11057201) has the molecular formula C15H13F2N5O3 and a molecular weight of 349.30 g/mol. Its IUPAC name is (E)-1-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-N-methoxymethanimine.
| Compound Name | (E)-1-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-N-methoxymethanimine |
|---|---|
| PubChem CID | 11057201 |
| Molecular Formula | C15H13F2N5O3 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (E)-1-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-N-methoxymethanimine |
| SMILES | CO/N=C(/C1=NCCON1)c1ccccc1Oc1ncnc(F)c1F |
| InChI | InChI=1S/C15H13F2N5O3/c1-23-21-12(14-18-6-7-24-22-14)9-4-2-3-5-10(9)25-15-11(16)13(17)19-8-20-15/h2-5,8H,6-7H2,1H3,(H,18,22)/b21-12+ |
| InChIKey | QSUYZJUVRWDNRZ-CIAFOILYSA-N |
| XLogP | 1.83 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|