C20H26N2O3 — CID 110572522
1-(2-methoxyethyl)-3-(4-methylphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione (PubChem CID 110572522) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-(4-methylphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(2-methoxyethyl)-3-(4-methylphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110572522 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-(2-methoxyethyl)-3-(4-methylphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione |
| SMILES | COCCN1C(=O)C(c2ccc(C)cc2)=C(N2CCC(C)CC2)C1=O |
| InChI | InChI=1S/C20H26N2O3/c1-14-4-6-16(7-5-14)17-18(21-10-8-15(2)9-11-21)20(24)22(19(17)23)12-13-25-3/h4-7,15H,8-13H2,1-3H3 |
| InChIKey | LEBKDLJDZBOJAK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|