C25H30N2O6 — CID 110573092
1-(3-ethoxypropyl)-3-(4-methylphenyl)-4-(3,4,5-trimethoxyanilino)pyrrole-2,5-dione (PubChem CID 110573092) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-(4-methylphenyl)-4-(3,4,5-trimethoxyanilino)pyrrole-2,5-dione.
| Compound Name | 1-(3-ethoxypropyl)-3-(4-methylphenyl)-4-(3,4,5-trimethoxyanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110573092 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-(4-methylphenyl)-4-(3,4,5-trimethoxyanilino)pyrrole-2,5-dione |
| SMILES | CCOCCCN1C(=O)C(Nc2cc(OC)c(OC)c(OC)c2)=C(c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C25H30N2O6/c1-6-33-13-7-12-27-24(28)21(17-10-8-16(2)9-11-17)22(25(27)29)26-18-14-19(30-3)23(32-5)20(15-18)31-4/h8-11,14-15,26H,6-7,12-13H2,1-5H3 |
| InChIKey | XNCXURVZXNMLLI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|