C23H31N3O4 — CID 110573107
3-(2,6-dimethylmorpholin-4-yl)-4-(4-methylphenyl)-1-(2-morpholin-4-ylethyl)pyrrole-2,5-dione (PubChem CID 110573107) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-4-(4-methylphenyl)-1-(2-morpholin-4-ylethyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-4-(4-methylphenyl)-1-(2-morpholin-4-ylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110573107 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-4-(4-methylphenyl)-1-(2-morpholin-4-ylethyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CC(C)OC(C)C3)C(=O)N(CCN3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H31N3O4/c1-16-4-6-19(7-5-16)20-21(25-14-17(2)30-18(3)15-25)23(28)26(22(20)27)9-8-24-10-12-29-13-11-24/h4-7,17-18H,8-15H2,1-3H3 |
| InChIKey | YUXWEHQROWZWLA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|