C27H27N5O2 — CID 110573632
1-(3,4-dimethylphenyl)-3-(4-methylphenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110573632) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(4-methylphenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(4-methylphenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110573632 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(4-methylphenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCN(c4ncccn4)CC3)C(=O)N(c3ccc(C)c(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H27N5O2/c1-18-5-8-21(9-6-18)23-24(30-13-15-31(16-14-30)27-28-11-4-12-29-27)26(34)32(25(23)33)22-10-7-19(2)20(3)17-22/h4-12,17H,13-16H2,1-3H3 |
| InChIKey | VXQIHCOXRRZUEB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|