C27H30N2O4 — CID 110573840
propyl 4-[3-(4-methylphenyl)-4-(3-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzoate (PubChem CID 110573840) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is propyl 4-[3-(4-methylphenyl)-4-(3-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzoate.
| Compound Name | propyl 4-[3-(4-methylphenyl)-4-(3-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 110573840 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | propyl 4-[3-(4-methylphenyl)-4-(3-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzoate |
| SMILES | CCCOC(=O)c1ccc(N2C(=O)C(c3ccc(C)cc3)=C(N3CCCC(C)C3)C2=O)cc1 |
| InChI | InChI=1S/C27H30N2O4/c1-4-16-33-27(32)21-11-13-22(14-12-21)29-25(30)23(20-9-7-18(2)8-10-20)24(26(29)31)28-15-5-6-19(3)17-28/h7-14,19H,4-6,15-17H2,1-3H3 |
| InChIKey | NLTJDYVOTJDXSL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|