About 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine]
1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine] (PubChem CID 11057472) has the molecular formula C21H20F3NO
and a molecular weight of 359.39 g/mol. Its IUPAC name is 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine].
Molecular Properties
| Compound Name | 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine] |
| PubChem CID | 11057472 |
| Molecular Formula | C21H20F3NO |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine] |
| SMILES | Fc1ccc(CCN2CCC3(C=Cc4cc(F)ccc4O3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H20F3NO/c22-17-3-4-20-16(13-17)5-7-21(26-20)8-11-25(12-9-21)10-6-15-1-2-18(23)14-19(15)24/h1-5,7,13-14H,6,8-12H2 |
| InChIKey | HTKIFNUUHOERMF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine]?
The IUPAC name of 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine] (CID 11057472) is 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine].
What is the SMILES notation for 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine]?
The canonical SMILES for 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine] is Fc1ccc(CCN2CCC3(C=Cc4cc(F)ccc4O3)CC2)c(F)c1.
What is the InChIKey of 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine]?
The InChIKey is HTKIFNUUHOERMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F3NO/c22-17-3-4-20-16(13-17)5-7-21(26-20)8-11-25(12-9-21)10-6-15-1-2-18(23)14-19(15)24/h1-5,7,13-14H,6,8-12H2.
What are the key properties of 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine]?
1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine] has a molecular weight of 359.39 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[2-(2,4-difluorophenyl)ethyl]-6-fluorospiro[chromene-2,4'-piperidine] is sourced from PubChem (CID 11057472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).