C19H31Cl2NO — CID 11057499
2,6-bis(chloromethyl)-3-dodecoxypyridine (PubChem CID 11057499) has the molecular formula C19H31Cl2NO and a molecular weight of 360.37 g/mol. Its IUPAC name is 2,6-bis(chloromethyl)-3-dodecoxypyridine.
| Compound Name | 2,6-bis(chloromethyl)-3-dodecoxypyridine |
|---|---|
| PubChem CID | 11057499 |
| Molecular Formula | C19H31Cl2NO |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2,6-bis(chloromethyl)-3-dodecoxypyridine |
| SMILES | CCCCCCCCCCCCOc1ccc(CCl)nc1CCl |
| InChI | InChI=1S/C19H31Cl2NO/c1-2-3-4-5-6-7-8-9-10-11-14-23-19-13-12-17(15-20)22-18(19)16-21/h12-13H,2-11,14-16H2,1H3 |
| InChIKey | BECQWIMJDLKNKF-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|