C21H29N3O3 — CID 110575164
3-(4-methylpiperazin-1-yl)-4-(4-propan-2-yloxyphenyl)-1-propylpyrrole-2,5-dione (PubChem CID 110575164) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-4-(4-propan-2-yloxyphenyl)-1-propylpyrrole-2,5-dione.
| Compound Name | 3-(4-methylpiperazin-1-yl)-4-(4-propan-2-yloxyphenyl)-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110575164 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-4-(4-propan-2-yloxyphenyl)-1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(c2ccc(OC(C)C)cc2)=C(N2CCN(C)CC2)C1=O |
| InChI | InChI=1S/C21H29N3O3/c1-5-10-24-20(25)18(16-6-8-17(9-7-16)27-15(2)3)19(21(24)26)23-13-11-22(4)12-14-23/h6-9,15H,5,10-14H2,1-4H3 |
| InChIKey | XPMIPJPKGLVUCA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|