C27H25NO3S — CID 110575763
1-(3,5-dimethylphenyl)-3-phenylsulfanyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione (PubChem CID 110575763) has the molecular formula C27H25NO3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-phenylsulfanyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3,5-dimethylphenyl)-3-phenylsulfanyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110575763 |
| Molecular Formula | C27H25NO3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-phenylsulfanyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)C(Sc3ccccc3)=C(c3ccc(OC(C)C)cc3)C2=O)c1 |
| InChI | InChI=1S/C27H25NO3S/c1-17(2)31-22-12-10-20(11-13-22)24-25(32-23-8-6-5-7-9-23)27(30)28(26(24)29)21-15-18(3)14-19(4)16-21/h5-17H,1-4H3 |
| InChIKey | QPUGCTNWPOYCSZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|