C25H28N2O3 — CID 110575970
3-(4-methylpiperidin-1-yl)-1-phenyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione (PubChem CID 110575970) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-(4-methylpiperidin-1-yl)-1-phenyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-methylpiperidin-1-yl)-1-phenyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110575970 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3-(4-methylpiperidin-1-yl)-1-phenyl-4-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
| SMILES | CC1CCN(C2=C(c3ccc(OC(C)C)cc3)C(=O)N(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C25H28N2O3/c1-17(2)30-21-11-9-19(10-12-21)22-23(26-15-13-18(3)14-16-26)25(29)27(24(22)28)20-7-5-4-6-8-20/h4-12,17-18H,13-16H2,1-3H3 |
| InChIKey | GPOGDFIRIFFNKD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|