C19H19N5O3 — CID 11057614
1-[[2-hydroxy-3-(5-methylbenzotriazol-2-yl)phenyl]methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 11057614) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-[[2-hydroxy-3-(5-methylbenzotriazol-2-yl)phenyl]methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-[[2-hydroxy-3-(5-methylbenzotriazol-2-yl)phenyl]methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11057614 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-[[2-hydroxy-3-(5-methylbenzotriazol-2-yl)phenyl]methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1ccc2nn(-c3cccc(CN4C(=O)NC(=O)C4(C)C)c3O)nc2c1 |
| InChI | InChI=1S/C19H19N5O3/c1-11-7-8-13-14(9-11)22-24(21-13)15-6-4-5-12(16(15)25)10-23-18(27)20-17(26)19(23,2)3/h4-9,25H,10H2,1-3H3,(H,20,26,27) |
| InChIKey | LBOJSKWOSSFSLI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|