C16H19Cl2N3O3 — CID 11057774
6-[(3,4-dichlorophenyl)methylamino]-3-(4-methoxybutyl)-1H-pyrimidine-2,4-dione (PubChem CID 11057774) has the molecular formula C16H19Cl2N3O3 and a molecular weight of 372.25 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenyl)methylamino]-3-(4-methoxybutyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(3,4-dichlorophenyl)methylamino]-3-(4-methoxybutyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11057774 |
| Molecular Formula | C16H19Cl2N3O3 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 6-[(3,4-dichlorophenyl)methylamino]-3-(4-methoxybutyl)-1H-pyrimidine-2,4-dione |
| SMILES | COCCCCn1c(=O)cc(NCc2ccc(Cl)c(Cl)c2)[nH]c1=O |
| InChI | InChI=1S/C16H19Cl2N3O3/c1-24-7-3-2-6-21-15(22)9-14(20-16(21)23)19-10-11-4-5-12(17)13(18)8-11/h4-5,8-9,19H,2-3,6-7,10H2,1H3,(H,20,23) |
| InChIKey | KBVQSQXMTYTXKG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|