C27H34N2O3 — CID 110579077
1-(3-butoxypropyl)-3-(2,4-dimethylphenyl)-4-(N-ethylanilino)pyrrole-2,5-dione (PubChem CID 110579077) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-(2,4-dimethylphenyl)-4-(N-ethylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(3-butoxypropyl)-3-(2,4-dimethylphenyl)-4-(N-ethylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110579077 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 1-(3-butoxypropyl)-3-(2,4-dimethylphenyl)-4-(N-ethylanilino)pyrrole-2,5-dione |
| SMILES | CCCCOCCCN1C(=O)C(c2ccc(C)cc2C)=C(N(CC)c2ccccc2)C1=O |
| InChI | InChI=1S/C27H34N2O3/c1-5-7-17-32-18-11-16-29-26(30)24(23-15-14-20(3)19-21(23)4)25(27(29)31)28(6-2)22-12-9-8-10-13-22/h8-10,12-15,19H,5-7,11,16-18H2,1-4H3 |
| InChIKey | SAWOLRMSDIEFQV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|