C14H18FN3O — CID 11057914
trans-(1R,3R)-N-(diaminomethylidene)-3-(4-fluoro-3-methylphenyl)-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 11057914) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is trans-(1R,3R)-N-(diaminomethylidene)-3-(4-fluoro-3-methylphenyl)-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-N-(diaminomethylidene)-3-(4-fluoro-3-methylphenyl)-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 11057914 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | trans-(1R,3R)-N-(diaminomethylidene)-3-(4-fluoro-3-methylphenyl)-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | Cc1cc([C@@H]2[C@@H](C(=O)N=C(N)N)C2(C)C)ccc1F |
| InChI | InChI=1S/C14H18FN3O/c1-7-6-8(4-5-9(7)15)10-11(14(10,2)3)12(19)18-13(16)17/h4-6,10-11H,1-3H3,(H4,16,17,18,19)/t10-,11+/m1/s1 |
| InChIKey | YRLSJNKMVJPCPC-MNOVXSKESA-N |
| XLogP | 1.67 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|