C12H12O4Se2 — CID 11057932
dimethyl (2E,5E)-4-(1,3-diselenol-2-ylidene)hepta-2,5-dienedioate (PubChem CID 11057932) has the molecular formula C12H12O4Se2 and a molecular weight of 378.14 g/mol. Its IUPAC name is dimethyl (2E,5E)-4-(1,3-diselenol-2-ylidene)hepta-2,5-dienedioate.
| Compound Name | dimethyl (2E,5E)-4-(1,3-diselenol-2-ylidene)hepta-2,5-dienedioate |
|---|---|
| PubChem CID | 11057932 |
| Molecular Formula | C12H12O4Se2 |
| Molecular Weight | 378.14 g/mol |
| Exact Mass | 379.91 |
| IUPAC Name | dimethyl (2E,5E)-4-(1,3-diselenol-2-ylidene)hepta-2,5-dienedioate |
| SMILES | COC(=O)/C=C/C(/C=C/C(=O)OC)=C1[Se]C=C[Se]1 |
| InChI | InChI=1S/C12H12O4Se2/c1-15-10(13)5-3-9(4-6-11(14)16-2)12-17-7-8-18-12/h3-8H,1-2H3/b5-3+,6-4+ |
| InChIKey | ZJJZPUYANFGPPG-GGWOSOGESA-N |
| XLogP | 0.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.14 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|