C24H25FN2O3 — CID 110579485
3-(2,6-dimethylmorpholin-4-yl)-4-(2,4-dimethylphenyl)-1-(2-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110579485) has the molecular formula C24H25FN2O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-4-(2,4-dimethylphenyl)-1-(2-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-4-(2,4-dimethylphenyl)-1-(2-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110579485 |
| Molecular Formula | C24H25FN2O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-4-(2,4-dimethylphenyl)-1-(2-fluorophenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CC(C)OC(C)C3)C(=O)N(c3ccccc3F)C2=O)c(C)c1 |
| InChI | InChI=1S/C24H25FN2O3/c1-14-9-10-18(15(2)11-14)21-22(26-12-16(3)30-17(4)13-26)24(29)27(23(21)28)20-8-6-5-7-19(20)25/h5-11,16-17H,12-13H2,1-4H3 |
| InChIKey | JOBZGXRQLMULMP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|