C28H34N2O3 — CID 110579690
1-(4-butylphenyl)-3-(2,4-dimethylphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione (PubChem CID 110579690) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-(2,4-dimethylphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione.
| Compound Name | 1-(4-butylphenyl)-3-(2,4-dimethylphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110579690 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 1-(4-butylphenyl)-3-(2,4-dimethylphenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]pyrrole-2,5-dione |
| SMILES | CCCCc1ccc(N2C(=O)C(c3ccc(C)cc3C)=C(N3CCCC(CO)C3)C2=O)cc1 |
| InChI | InChI=1S/C28H34N2O3/c1-4-5-7-21-10-12-23(13-11-21)30-27(32)25(24-14-9-19(2)16-20(24)3)26(28(30)33)29-15-6-8-22(17-29)18-31/h9-14,16,22,31H,4-8,15,17-18H2,1-3H3 |
| InChIKey | HVLNHSRHHUSFGX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|