C29H30N2O2 — CID 110579739
3-[benzyl(ethyl)amino]-1-(2,3-dimethylphenyl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110579739) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-[benzyl(ethyl)amino]-1-(2,3-dimethylphenyl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[benzyl(ethyl)amino]-1-(2,3-dimethylphenyl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110579739 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 3-[benzyl(ethyl)amino]-1-(2,3-dimethylphenyl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | CCN(Cc1ccccc1)C1=C(c2ccc(C)cc2C)C(=O)N(c2cccc(C)c2C)C1=O |
| InChI | InChI=1S/C29H30N2O2/c1-6-30(18-23-12-8-7-9-13-23)27-26(24-16-15-19(2)17-21(24)4)28(32)31(29(27)33)25-14-10-11-20(3)22(25)5/h7-17H,6,18H2,1-5H3 |
| InChIKey | UFLRHOOANRWTAI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|