C27H30N2O4 — CID 110580610
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4-dimethylphenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrrole-2,5-dione (PubChem CID 110580610) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4-dimethylphenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4-dimethylphenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110580610 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,4-dimethylphenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CC(C)CC(C)C3)C(=O)N(c3ccc4c(c3)OCCO4)C2=O)c(C)c1 |
| InChI | InChI=1S/C27H30N2O4/c1-16-5-7-21(19(4)12-16)24-25(28-14-17(2)11-18(3)15-28)27(31)29(26(24)30)20-6-8-22-23(13-20)33-10-9-32-22/h5-8,12-13,17-18H,9-11,14-15H2,1-4H3 |
| InChIKey | XEUGGKFXHDROCK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|