C23H29N5O — CID 11058267
2a-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one (PubChem CID 11058267) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is 2a-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one.
| Compound Name | 2a-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
|---|---|
| PubChem CID | 11058267 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 2a-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,3,4,5-tetrahydrobenzo[cd]indol-2-one |
| SMILES | O=C1Nc2cccc3c2C1(CCCCN1CCN(c2ncccn2)CC1)CCC3 |
| InChI | InChI=1S/C23H29N5O/c29-21-23(10-4-7-18-6-3-8-19(26-21)20(18)23)9-1-2-13-27-14-16-28(17-15-27)22-24-11-5-12-25-22/h3,5-6,8,11-12H,1-2,4,7,9-10,13-17H2,(H,26,29) |
| InChIKey | BYXJWMSTONFNEX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|