C24H27NO4 — CID 11058313
tert-butyl (3S,5S,6R)-2-oxo-5,6-diphenyl-3-prop-2-enylmorpholine-4-carboxylate (PubChem CID 11058313) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl (3S,5S,6R)-2-oxo-5,6-diphenyl-3-prop-2-enylmorpholine-4-carboxylate.
| Compound Name | tert-butyl (3S,5S,6R)-2-oxo-5,6-diphenyl-3-prop-2-enylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 11058313 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | tert-butyl (3S,5S,6R)-2-oxo-5,6-diphenyl-3-prop-2-enylmorpholine-4-carboxylate |
| SMILES | C=CC[C@H]1C(=O)O[C@H](c2ccccc2)[C@H](c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H27NO4/c1-5-12-19-22(26)28-21(18-15-10-7-11-16-18)20(17-13-8-6-9-14-17)25(19)23(27)29-24(2,3)4/h5-11,13-16,19-21H,1,12H2,2-4H3/t19-,20-,21+/m0/s1 |
| InChIKey | JFYVSCSGKFZNON-PCCBWWKXSA-N |
| XLogP | 5.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|