C17H11ClFNO2 — CID 110583442
3-chloro-1-[(2-fluorophenyl)methyl]-4-phenylpyrrole-2,5-dione (PubChem CID 110583442) has the molecular formula C17H11ClFNO2 and a molecular weight of 315.73 g/mol. Its IUPAC name is 3-chloro-1-[(2-fluorophenyl)methyl]-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-chloro-1-[(2-fluorophenyl)methyl]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583442 |
| Molecular Formula | C17H11ClFNO2 |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 3-chloro-1-[(2-fluorophenyl)methyl]-4-phenylpyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(c2ccccc2)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C17H11ClFNO2/c18-15-14(11-6-2-1-3-7-11)16(21)20(17(15)22)10-12-8-4-5-9-13(12)19/h1-9H,10H2 |
| InChIKey | LWIOIBIIDSTBSN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|