C22H14N4O4 — CID 1105842
2,6-bis(4-methyl-2-pyridinyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 1105842) has the molecular formula C22H14N4O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is 2,6-bis(4-methyl-2-pyridinyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(4-methyl-2-pyridinyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 1105842 |
| Molecular Formula | C22H14N4O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2,6-bis(4-methyl-2-pyridinyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccnc(-n2c(=O)c3cc4c(=O)n(-c5cc(C)ccn5)c(=O)c4cc3c2=O)c1 |
| InChI | InChI=1S/C22H14N4O4/c1-11-3-5-23-17(7-11)25-19(27)13-9-15-16(10-14(13)20(25)28)22(30)26(21(15)29)18-8-12(2)4-6-24-18/h3-10H,1-2H3 |
| InChIKey | SXDOXXTZKCOGOK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 103.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |