C19H14Cl3NO3 — CID 110584631
3-chloro-1-(3,5-dichlorophenyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione (PubChem CID 110584631) has the molecular formula C19H14Cl3NO3 and a molecular weight of 410.68 g/mol. Its IUPAC name is 3-chloro-1-(3,5-dichlorophenyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(3,5-dichlorophenyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110584631 |
| Molecular Formula | C19H14Cl3NO3 |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | 3-chloro-1-(3,5-dichlorophenyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCOc1ccc(C2=C(Cl)C(=O)N(c3cc(Cl)cc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C19H14Cl3NO3/c1-2-7-26-15-5-3-11(4-6-15)16-17(22)19(25)23(18(16)24)14-9-12(20)8-13(21)10-14/h3-6,8-10H,2,7H2,1H3 |
| InChIKey | UTSCXHCIDVDLTM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|