C25H36O4 — CID 11058468
[(1'R,2'S,4S,4'S,5R)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-benzylbutanoate (PubChem CID 11058468) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is [(1'R,2'S,4S,4'S,5R)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-benzylbutanoate.
| Compound Name | [(1'R,2'S,4S,4'S,5R)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-benzylbutanoate |
|---|---|
| PubChem CID | 11058468 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [(1'R,2'S,4S,4'S,5R)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-benzylbutanoate |
| SMILES | CCC(Cc1ccccc1)C(=O)O[C@@H]1C2(O[C@@H](C)[C@@H](C)O2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C25H36O4/c1-7-19(15-18-11-9-8-10-12-18)21(26)27-22-24(6)14-13-20(23(24,4)5)25(22)28-16(2)17(3)29-25/h8-12,16-17,19-20,22H,7,13-15H2,1-6H3/t16-,17+,19?,20-,22-,24-,25?/m0/s1 |
| InChIKey | XGTMXALPKMGWAR-JDSQUILISA-N |
| XLogP | 5.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |