C25H30FN3O3 — CID 110586533
1-(3-butoxypropyl)-3-[4-(dimethylamino)anilino]-4-(4-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110586533) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[4-(dimethylamino)anilino]-4-(4-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-butoxypropyl)-3-[4-(dimethylamino)anilino]-4-(4-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110586533 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[4-(dimethylamino)anilino]-4-(4-fluorophenyl)pyrrole-2,5-dione |
| SMILES | CCCCOCCCN1C(=O)C(Nc2ccc(N(C)C)cc2)=C(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C25H30FN3O3/c1-4-5-16-32-17-6-15-29-24(30)22(18-7-9-19(26)10-8-18)23(25(29)31)27-20-11-13-21(14-12-20)28(2)3/h7-14,27H,4-6,15-17H2,1-3H3 |
| InChIKey | FJJYNLKHJIMVAX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|