C28H20F2O — CID 11058671
(1S,8R,9R,10S)-9-fluoro-10-(4-fluorophenyl)-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 11058671) has the molecular formula C28H20F2O and a molecular weight of 410.46 g/mol. Its IUPAC name is (1S,8R,9R,10S)-9-fluoro-10-(4-fluorophenyl)-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8R,9R,10S)-9-fluoro-10-(4-fluorophenyl)-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 11058671 |
| Molecular Formula | C28H20F2O |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (1S,8R,9R,10S)-9-fluoro-10-(4-fluorophenyl)-1,8-diphenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | Fc1ccc([C@@H]2[C@@H](F)[C@]3(c4ccccc4)O[C@@]2(c2ccccc2)c2ccccc23)cc1 |
| InChI | InChI=1S/C28H20F2O/c29-22-17-15-19(16-18-22)25-26(30)28(21-11-5-2-6-12-21)24-14-8-7-13-23(24)27(25,31-28)20-9-3-1-4-10-20/h1-18,25-26H/t25-,26-,27+,28-/m1/s1 |
| InChIKey | DIWLHQDVQQRVNS-ZZXHUEHTSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |