C25H34N2O3 — CID 11058677
3-(dibenzylamino)propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11058677) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 3-(dibenzylamino)propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | 3-(dibenzylamino)propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11058677 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 3-(dibenzylamino)propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)COC(C)(C)N1C(=O)OCCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H34N2O3/c1-24(2)20-30-25(3,4)27(24)23(28)29-17-11-16-26(18-21-12-7-5-8-13-21)19-22-14-9-6-10-15-22/h5-10,12-15H,11,16-20H2,1-4H3 |
| InChIKey | FPVBDHXCFUAVRA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|