C25H23N3O4 — CID 110587704
3-(4-ethoxyphenyl)-4-(3-methoxyanilino)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione (PubChem CID 110587704) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-4-(3-methoxyanilino)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-ethoxyphenyl)-4-(3-methoxyanilino)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110587704 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3-(4-ethoxyphenyl)-4-(3-methoxyanilino)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(Nc3cccc(OC)c3)C(=O)N(Cc3ccncc3)C2=O)cc1 |
| InChI | InChI=1S/C25H23N3O4/c1-3-32-20-9-7-18(8-10-20)22-23(27-19-5-4-6-21(15-19)31-2)25(30)28(24(22)29)16-17-11-13-26-14-12-17/h4-15,27H,3,16H2,1-2H3 |
| InChIKey | LWEMEYVBTYSDSY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|