C24H28N2O5 — CID 110587906
3-(4-ethoxyanilino)-4-(4-ethoxyphenyl)-1-(3-methoxypropyl)pyrrole-2,5-dione (PubChem CID 110587906) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-(4-ethoxyanilino)-4-(4-ethoxyphenyl)-1-(3-methoxypropyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-ethoxyanilino)-4-(4-ethoxyphenyl)-1-(3-methoxypropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110587906 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-(4-ethoxyanilino)-4-(4-ethoxyphenyl)-1-(3-methoxypropyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(NC2=C(c3ccc(OCC)cc3)C(=O)N(CCCOC)C2=O)cc1 |
| InChI | InChI=1S/C24H28N2O5/c1-4-30-19-11-7-17(8-12-19)21-22(24(28)26(23(21)27)15-6-16-29-3)25-18-9-13-20(14-10-18)31-5-2/h7-14,25H,4-6,15-16H2,1-3H3 |
| InChIKey | FPGDDPNCMINFNC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|