C26H23ClN2O3 — CID 110588294
1-(4-chlorophenyl)-3-(2,3-dimethylanilino)-4-(4-ethoxyphenyl)pyrrole-2,5-dione (PubChem CID 110588294) has the molecular formula C26H23ClN2O3 and a molecular weight of 446.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,3-dimethylanilino)-4-(4-ethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(4-chlorophenyl)-3-(2,3-dimethylanilino)-4-(4-ethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110588294 |
| Molecular Formula | C26H23ClN2O3 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,3-dimethylanilino)-4-(4-ethoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(Nc3cccc(C)c3C)C(=O)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H23ClN2O3/c1-4-32-21-14-8-18(9-15-21)23-24(28-22-7-5-6-16(2)17(22)3)26(31)29(25(23)30)20-12-10-19(27)11-13-20/h5-15,28H,4H2,1-3H3 |
| InChIKey | ZDUTYVLOXMODFL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|