C29H30N2O3 — CID 110588390
3-(3,5-dimethylanilino)-4-(4-ethoxyphenyl)-1-(4-propan-2-ylphenyl)pyrrole-2,5-dione (PubChem CID 110588390) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-(3,5-dimethylanilino)-4-(4-ethoxyphenyl)-1-(4-propan-2-ylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethylanilino)-4-(4-ethoxyphenyl)-1-(4-propan-2-ylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110588390 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 3-(3,5-dimethylanilino)-4-(4-ethoxyphenyl)-1-(4-propan-2-ylphenyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(Nc3cc(C)cc(C)c3)C(=O)N(c3ccc(C(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H30N2O3/c1-6-34-25-13-9-22(10-14-25)26-27(30-23-16-19(4)15-20(5)17-23)29(33)31(28(26)32)24-11-7-21(8-12-24)18(2)3/h7-18,30H,6H2,1-5H3 |
| InChIKey | NBOLICWDPKMQRP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|