C26H23ClN2O4 — CID 110588522
3-(3-chloro-4-methoxyanilino)-4-(3,4-dimethylphenyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110588522) has the molecular formula C26H23ClN2O4 and a molecular weight of 462.93 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyanilino)-4-(3,4-dimethylphenyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3-chloro-4-methoxyanilino)-4-(3,4-dimethylphenyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110588522 |
| Molecular Formula | C26H23ClN2O4 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 3-(3-chloro-4-methoxyanilino)-4-(3,4-dimethylphenyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1cccc(N2C(=O)C(Nc3ccc(OC)c(Cl)c3)=C(c3ccc(C)c(C)c3)C2=O)c1 |
| InChI | InChI=1S/C26H23ClN2O4/c1-15-8-9-17(12-16(15)2)23-24(28-18-10-11-22(33-4)21(27)13-18)26(31)29(25(23)30)19-6-5-7-20(14-19)32-3/h5-14,28H,1-4H3 |
| InChIKey | FCPDCICDWSQNSK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|