C26H31ClN2O3 — CID 110589144
1-(3-butoxypropyl)-3-(5-chloro-2-methylanilino)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110589144) has the molecular formula C26H31ClN2O3 and a molecular weight of 455.00 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-(5-chloro-2-methylanilino)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-butoxypropyl)-3-(5-chloro-2-methylanilino)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110589144 |
| Molecular Formula | C26H31ClN2O3 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 1-(3-butoxypropyl)-3-(5-chloro-2-methylanilino)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | CCCCOCCCN1C(=O)C(Nc2cc(Cl)ccc2C)=C(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C26H31ClN2O3/c1-5-6-13-32-14-7-12-29-25(30)23(20-10-8-17(2)19(4)15-20)24(26(29)31)28-22-16-21(27)11-9-18(22)3/h8-11,15-16,28H,5-7,12-14H2,1-4H3 |
| InChIKey | CSMZGUDCQSKCDH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|